C13H16ClN3O — CID 54847456
4-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N,N-diethylaniline (PubChem CID 54847456) has the molecular formula C13H16ClN3O and a molecular weight of 265.74 g/mol. Its IUPAC name is 4-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N,N-diethylaniline.
| Compound Name | 4-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 54847456 |
| Molecular Formula | C13H16ClN3O |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(-c2noc(CCl)n2)cc1 |
| InChI | InChI=1S/C13H16ClN3O/c1-3-17(4-2)11-7-5-10(6-8-11)13-15-12(9-14)18-16-13/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | WIVIHCGHUGCTGN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|