C19H18Cl2N4 — CID 101468768
4-[4-(4,6-dichloro-1,3,5-triazin-2-yl)phenyl]-N,N-diethylaniline (PubChem CID 101468768) has the molecular formula C19H18Cl2N4 and a molecular weight of 373.29 g/mol. Its IUPAC name is 4-[4-(4,6-dichloro-1,3,5-triazin-2-yl)phenyl]-N,N-diethylaniline.
| Compound Name | 4-[4-(4,6-dichloro-1,3,5-triazin-2-yl)phenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 101468768 |
| Molecular Formula | C19H18Cl2N4 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 4-[4-(4,6-dichloro-1,3,5-triazin-2-yl)phenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(-c2ccc(-c3nc(Cl)nc(Cl)n3)cc2)cc1 |
| InChI | InChI=1S/C19H18Cl2N4/c1-3-25(4-2)16-11-9-14(10-12-16)13-5-7-15(8-6-13)17-22-18(20)24-19(21)23-17/h5-12H,3-4H2,1-2H3 |
| InChIKey | CGNLTXJFNBDUEN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |