C19H26N2O2 — CID 18004124
4-(2,6-diethoxy-4-pyridinyl)-N,N-diethylaniline (PubChem CID 18004124) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-(2,6-diethoxy-4-pyridinyl)-N,N-diethylaniline.
| Compound Name | 4-(2,6-diethoxy-4-pyridinyl)-N,N-diethylaniline |
|---|---|
| PubChem CID | 18004124 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 4-(2,6-diethoxy-4-pyridinyl)-N,N-diethylaniline |
| SMILES | CCOc1cc(-c2ccc(N(CC)CC)cc2)cc(OCC)n1 |
| InChI | InChI=1S/C19H26N2O2/c1-5-21(6-2)17-11-9-15(10-12-17)16-13-18(22-7-3)20-19(14-16)23-8-4/h9-14H,5-8H2,1-4H3 |
| InChIKey | CCCQQGOSIXDPDW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |