C17H24N2O — CID 6857
View drug profile → quinisocaine2-(3-butylisoquinolin-1-yl)oxy-N,N-dimethylethanamine (PubChem CID 6857) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-(3-butylisoquinolin-1-yl)oxy-N,N-dimethylethanamine.
| Compound Name | 2-(3-butylisoquinolin-1-yl)oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 6857 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 2-(3-butylisoquinolin-1-yl)oxy-N,N-dimethylethanamine |
| SMILES | CCCCc1cc2ccccc2c(OCCN(C)C)n1 |
| InChI | InChI=1S/C17H24N2O/c1-4-5-9-15-13-14-8-6-7-10-16(14)17(18-15)20-12-11-19(2)3/h6-8,10,13H,4-5,9,11-12H2,1-3H3 |
| InChIKey | XNMYNYSCEJBRPZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |