C23H22N2O — CID 10337448
6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanenitrile (PubChem CID 10337448) has the molecular formula C23H22N2O and a molecular weight of 342.44 g/mol. Its IUPAC name is 6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanenitrile.
| Compound Name | 6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanenitrile |
|---|---|
| PubChem CID | 10337448 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanenitrile |
| SMILES | N#CCCCCCOc1cc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H22N2O/c24-15-9-1-2-10-16-26-23-18-21(19-11-5-3-6-12-19)17-22(25-23)20-13-7-4-8-14-20/h3-8,11-14,17-18H,1-2,9-10,16H2 |
| InChIKey | BVTSGHBSZIPCSF-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|