C6H5ClN4O — CID 137213742
5-(chloromethyl)-3-(1H-pyrazol-4-yl)-1,2,4-oxadiazole (PubChem CID 137213742) has the molecular formula C6H5ClN4O and a molecular weight of 184.59 g/mol. Its IUPAC name is 5-(chloromethyl)-3-(1H-pyrazol-4-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(chloromethyl)-3-(1H-pyrazol-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 137213742 |
| Molecular Formula | C6H5ClN4O |
| Molecular Weight | 184.59 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | 5-(chloromethyl)-3-(1H-pyrazol-4-yl)-1,2,4-oxadiazole |
| SMILES | ClCc1nc(-c2cn[nH]c2)no1 |
| InChI | InChI=1S/C6H5ClN4O/c7-1-5-10-6(11-12-5)4-2-8-9-3-4/h2-3H,1H2,(H,8,9) |
| InChIKey | WGXXPOQZYPNRIX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.59 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|