C10H11N5OS — CID 134354986
N-cyclopropylsulfanyl-1-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methanamine (PubChem CID 134354986) has the molecular formula C10H11N5OS and a molecular weight of 249.30 g/mol. Its IUPAC name is N-cyclopropylsulfanyl-1-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methanamine.
| Compound Name | N-cyclopropylsulfanyl-1-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 134354986 |
| Molecular Formula | C10H11N5OS |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | N-cyclopropylsulfanyl-1-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)methanamine |
| SMILES | c1cnc(-c2noc(CNSC3CC3)n2)cn1 |
| InChI | InChI=1S/C10H11N5OS/c1-2-7(1)17-13-6-9-14-10(15-16-9)8-5-11-3-4-12-8/h3-5,7,13H,1-2,6H2 |
| InChIKey | JRTRJIDYISMBFF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|