C18H15N3O3 — CID 135590193
[4-[(E)-2-[3-(2-hydroxyphenyl)-1H-1,2,4-triazol-5-yl]ethenyl]phenyl] acetate (PubChem CID 135590193) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is [4-[(E)-2-[3-(2-hydroxyphenyl)-1H-1,2,4-triazol-5-yl]ethenyl]phenyl] acetate.
| Compound Name | [4-[(E)-2-[3-(2-hydroxyphenyl)-1H-1,2,4-triazol-5-yl]ethenyl]phenyl] acetate |
|---|---|
| PubChem CID | 135590193 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | [4-[(E)-2-[3-(2-hydroxyphenyl)-1H-1,2,4-triazol-5-yl]ethenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/C=C/c2nc(-c3ccccc3O)n[nH]2)cc1 |
| InChI | InChI=1S/C18H15N3O3/c1-12(22)24-14-9-6-13(7-10-14)8-11-17-19-18(21-20-17)15-4-2-3-5-16(15)23/h2-11,23H,1H3,(H,19,20,21)/b11-8+ |
| InChIKey | IDANBRHRDOJICR-DHZHZOJOSA-N |
| XLogP | 3.27 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|