C16H12ClN3O — CID 2952229
2-[5-[2-(4-chlorophenyl)ethenyl]-1H-1,2,4-triazol-3-yl]phenol (PubChem CID 2952229) has the molecular formula C16H12ClN3O and a molecular weight of 297.75 g/mol. Its IUPAC name is 2-[5-[2-(4-chlorophenyl)ethenyl]-1H-1,2,4-triazol-3-yl]phenol.
| Compound Name | 2-[5-[2-(4-chlorophenyl)ethenyl]-1H-1,2,4-triazol-3-yl]phenol |
|---|---|
| PubChem CID | 2952229 |
| Molecular Formula | C16H12ClN3O |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-[5-[2-(4-chlorophenyl)ethenyl]-1H-1,2,4-triazol-3-yl]phenol |
| SMILES | Oc1ccccc1-c1n[nH]c(C=Cc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H12ClN3O/c17-12-8-5-11(6-9-12)7-10-15-18-16(20-19-15)13-3-1-2-4-14(13)21/h1-10,21H,(H,18,19,20) |
| InChIKey | FWVBIBBFANNCGF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |