C17H10N2O4 — CID 135842838
3-hydroxy-2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]inden-1-one (PubChem CID 135842838) has the molecular formula C17H10N2O4 and a molecular weight of 306.28 g/mol. Its IUPAC name is 3-hydroxy-2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]inden-1-one.
| Compound Name | 3-hydroxy-2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]inden-1-one |
|---|---|
| PubChem CID | 135842838 |
| Molecular Formula | C17H10N2O4 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 3-hydroxy-2-[5-(2-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]inden-1-one |
| SMILES | O=C1C(c2noc(-c3ccccc3O)n2)=C(O)c2ccccc21 |
| InChI | InChI=1S/C17H10N2O4/c20-12-8-4-3-7-11(12)17-18-16(19-23-17)13-14(21)9-5-1-2-6-10(9)15(13)22/h1-8,20-21H |
| InChIKey | LPHOPWKNTUORDY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'} |
|---|