C15H8N2O4 — CID 135867848
2-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-3-hydroxyinden-1-one (PubChem CID 135867848) has the molecular formula C15H8N2O4 and a molecular weight of 280.24 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-3-hydroxyinden-1-one.
| Compound Name | 2-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-3-hydroxyinden-1-one |
|---|---|
| PubChem CID | 135867848 |
| Molecular Formula | C15H8N2O4 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2-[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]-3-hydroxyinden-1-one |
| SMILES | O=C1C(c2nnc(-c3ccco3)o2)=C(O)c2ccccc21 |
| InChI | InChI=1S/C15H8N2O4/c18-12-8-4-1-2-5-9(8)13(19)11(12)15-17-16-14(21-15)10-6-3-7-20-10/h1-7,18H |
| InChIKey | RPLXKKJRYKCNLG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'} |
|---|