C19H15N3O6 — CID 9362957
[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 9362957) has the molecular formula C19H15N3O6 and a molecular weight of 381.34 g/mol. Its IUPAC name is [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 9362957 |
| Molecular Formula | C19H15N3O6 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)OCc1nnc(-c2ccco2)o1 |
| InChI | InChI=1S/C19H15N3O6/c23-16(27-11-15-20-21-17(28-15)14-7-4-10-26-14)8-3-9-22-18(24)12-5-1-2-6-13(12)19(22)25/h1-2,4-7,10H,3,8-9,11H2 |
| InChIKey | JIWLCGUOXVCFLY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 115.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|