C15H11N3O6 — CID 8765731
[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 2-(2-nitrophenyl)acetate (PubChem CID 8765731) has the molecular formula C15H11N3O6 and a molecular weight of 329.27 g/mol. Its IUPAC name is [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 2-(2-nitrophenyl)acetate.
| Compound Name | [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 2-(2-nitrophenyl)acetate |
|---|---|
| PubChem CID | 8765731 |
| Molecular Formula | C15H11N3O6 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 2-(2-nitrophenyl)acetate |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])OCc1nnc(-c2ccco2)o1 |
| InChI | InChI=1S/C15H11N3O6/c19-14(8-10-4-1-2-5-11(10)18(20)21)23-9-13-16-17-15(24-13)12-6-3-7-22-12/h1-7H,8-9H2 |
| InChIKey | UREDEOPVTZPHST-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 121.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|