C15H12N2O5 — CID 7980221
[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 2-phenoxyacetate (PubChem CID 7980221) has the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. Its IUPAC name is [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 2-phenoxyacetate.
| Compound Name | [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 2-phenoxyacetate |
|---|---|
| PubChem CID | 7980221 |
| Molecular Formula | C15H12N2O5 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 2-phenoxyacetate |
| SMILES | O=C(COc1ccccc1)OCc1nnc(-c2ccco2)o1 |
| InChI | InChI=1S/C15H12N2O5/c18-14(10-20-11-5-2-1-3-6-11)21-9-13-16-17-15(22-13)12-7-4-8-19-12/h1-8H,9-10H2 |
| InChIKey | DUOUVYHBAWEECY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 87.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |