C20H14N2O5 — CID 7985148
[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 3-phenoxybenzoate (PubChem CID 7985148) has the molecular formula C20H14N2O5 and a molecular weight of 362.34 g/mol. Its IUPAC name is [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 3-phenoxybenzoate.
| Compound Name | [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 3-phenoxybenzoate |
|---|---|
| PubChem CID | 7985148 |
| Molecular Formula | C20H14N2O5 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 3-phenoxybenzoate |
| SMILES | O=C(OCc1nnc(-c2ccco2)o1)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H14N2O5/c23-20(25-13-18-21-22-19(27-18)17-10-5-11-24-17)14-6-4-9-16(12-14)26-15-7-2-1-3-8-15/h1-12H,13H2 |
| InChIKey | LPOYIBBNYBOHTN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 87.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |