C17H13N3O6 — CID 7769865
(5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(4-nitrophenoxy)acetate (PubChem CID 7769865) has the molecular formula C17H13N3O6 and a molecular weight of 355.31 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(4-nitrophenoxy)acetate.
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(4-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 7769865 |
| Molecular Formula | C17H13N3O6 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(4-nitrophenoxy)acetate |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)OCc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C17H13N3O6/c21-16(11-24-14-8-6-13(7-9-14)20(22)23)25-10-15-18-19-17(26-15)12-4-2-1-3-5-12/h1-9H,10-11H2 |
| InChIKey | SUTFXABBKHTNPY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 117.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|