C12H7N3O7 — CID 9454803
[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 5-nitrofuran-2-carboxylate (PubChem CID 9454803) has the molecular formula C12H7N3O7 and a molecular weight of 305.20 g/mol. Its IUPAC name is [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 5-nitrofuran-2-carboxylate.
| Compound Name | [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 9454803 |
| Molecular Formula | C12H7N3O7 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | [5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methyl 5-nitrofuran-2-carboxylate |
| SMILES | O=C(OCc1nnc(-c2ccco2)o1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C12H7N3O7/c16-12(8-3-4-10(21-8)15(17)18)20-6-9-13-14-11(22-9)7-2-1-5-19-7/h1-5H,6H2 |
| InChIKey | KXWWKRGNAHDEAT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 134.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|