C14H8N6O2 — CID 168608475
2-[4-hydroxy-3-(5-methyl-1,3,4-oxadiazol-2-yl)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168608475) has the molecular formula C14H8N6O2 and a molecular weight of 292.26 g/mol. Its IUPAC name is 2-[4-hydroxy-3-(5-methyl-1,3,4-oxadiazol-2-yl)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-hydroxy-3-(5-methyl-1,3,4-oxadiazol-2-yl)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168608475 |
| Molecular Formula | C14H8N6O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-[4-hydroxy-3-(5-methyl-1,3,4-oxadiazol-2-yl)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | Cc1nnc(-c2cc(NC(C#N)=C(C#N)C#N)ccc2O)o1 |
| InChI | InChI=1S/C14H8N6O2/c1-8-19-20-14(22-8)11-4-10(2-3-13(11)21)18-12(7-17)9(5-15)6-16/h2-4,18,21H,1H3 |
| InChIKey | HGDKHQUJALUWGZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|