C17H8N6O2 — CID 168610712
2-[3-hydroxy-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168610712) has the molecular formula C17H8N6O2 and a molecular weight of 328.29 g/mol. Its IUPAC name is 2-[3-hydroxy-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[3-hydroxy-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168610712 |
| Molecular Formula | C17H8N6O2 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2-[3-hydroxy-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(-c2nc3ncccc3o2)c(O)c1 |
| InChI | InChI=1S/C17H8N6O2/c18-7-10(8-19)13(9-20)22-11-3-4-12(14(24)6-11)17-23-16-15(25-17)2-1-5-21-16/h1-6,22,24H |
| InChIKey | LSIANCSHAUBFCL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|