C19H13N3O3 — CID 4088215
N-[4-(1,3-benzoxazol-2-yl)-3-hydroxyphenyl]pyridine-3-carboxamide (PubChem CID 4088215) has the molecular formula C19H13N3O3 and a molecular weight of 331.33 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-yl)-3-hydroxyphenyl]pyridine-3-carboxamide.
| Compound Name | N-[4-(1,3-benzoxazol-2-yl)-3-hydroxyphenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 4088215 |
| Molecular Formula | C19H13N3O3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-yl)-3-hydroxyphenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3o2)c(O)c1)c1cccnc1 |
| InChI | InChI=1S/C19H13N3O3/c23-16-10-13(21-18(24)12-4-3-9-20-11-12)7-8-14(16)19-22-15-5-1-2-6-17(15)25-19/h1-11,23H,(H,21,24) |
| InChIKey | DNVWXOYSUGBANI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |