C15H8N6O — CID 169338870
2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169338870) has the molecular formula C15H8N6O and a molecular weight of 288.27 g/mol. Its IUPAC name is 2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169338870 |
| Molecular Formula | C15H8N6O |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1cccc(-c2nc3ncccc3o2)c1 |
| InChI | InChI=1S/C15H8N6O/c16-8-12(9-17)21-20-11-4-1-3-10(7-11)15-19-14-13(22-15)5-2-6-18-14/h1-7,20H |
| InChIKey | MNDOENGMZLDLGE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|