C19H15N3O4S — CID 136867216
methyl (Z)-3-[4-(1,3-benzoxazol-2-yl)-3-hydroxyanilino]-2-cyano-3-methylsulfanylprop-2-enoate (PubChem CID 136867216) has the molecular formula C19H15N3O4S and a molecular weight of 381.41 g/mol. Its IUPAC name is methyl (Z)-3-[4-(1,3-benzoxazol-2-yl)-3-hydroxyanilino]-2-cyano-3-methylsulfanylprop-2-enoate.
| Compound Name | methyl (Z)-3-[4-(1,3-benzoxazol-2-yl)-3-hydroxyanilino]-2-cyano-3-methylsulfanylprop-2-enoate |
|---|---|
| PubChem CID | 136867216 |
| Molecular Formula | C19H15N3O4S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | methyl (Z)-3-[4-(1,3-benzoxazol-2-yl)-3-hydroxyanilino]-2-cyano-3-methylsulfanylprop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C(/Nc1ccc(-c2nc3ccccc3o2)c(O)c1)SC |
| InChI | InChI=1S/C19H15N3O4S/c1-25-19(24)13(10-20)18(27-2)21-11-7-8-12(15(23)9-11)17-22-14-5-3-4-6-16(14)26-17/h3-9,21,23H,1-2H3/b18-13- |
| InChIKey | SCAIMRBISBUKPX-AQTBWJFISA-N |
| XLogP | 3.88 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|