C14H8N6O — CID 168608062
2-[3-(3-methyl-1,2,4-oxadiazol-5-yl)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168608062) has the molecular formula C14H8N6O and a molecular weight of 276.26 g/mol. Its IUPAC name is 2-[3-(3-methyl-1,2,4-oxadiazol-5-yl)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[3-(3-methyl-1,2,4-oxadiazol-5-yl)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168608062 |
| Molecular Formula | C14H8N6O |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-[3-(3-methyl-1,2,4-oxadiazol-5-yl)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | Cc1noc(-c2cccc(NC(C#N)=C(C#N)C#N)c2)n1 |
| InChI | InChI=1S/C14H8N6O/c1-9-18-14(21-20-9)10-3-2-4-12(5-10)19-13(8-17)11(6-15)7-16/h2-5,19H,1H3 |
| InChIKey | QQZVWXYQOJNYJC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|