About 6-bromo-2-[3-(1,2,2-tricyanoethenylamino)phenyl]quinoline-4-carboxylic acid
6-bromo-2-[3-(1,2,2-tricyanoethenylamino)phenyl]quinoline-4-carboxylic acid (PubChem CID 168608649) has the molecular formula C21H10BrN5O2
and a molecular weight of 444.25 g/mol. Its IUPAC name is 6-bromo-2-[3-(1,2,2-tricyanoethenylamino)phenyl]quinoline-4-carboxylic acid.
Molecular Properties
| Compound Name | 6-bromo-2-[3-(1,2,2-tricyanoethenylamino)phenyl]quinoline-4-carboxylic acid |
| PubChem CID | 168608649 |
| Molecular Formula | C21H10BrN5O2 |
| Molecular Weight | 444.25 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | 6-bromo-2-[3-(1,2,2-tricyanoethenylamino)phenyl]quinoline-4-carboxylic acid |
| SMILES | N#CC(C#N)=C(C#N)Nc1cccc(-c2cc(C(=O)O)c3cc(Br)ccc3n2)c1 |
| InChI | InChI=1S/C21H10BrN5O2/c22-14-4-5-18-16(7-14)17(21(28)29)8-19(27-18)12-2-1-3-15(6-12)26-20(11-25)13(9-23)10-24/h1-8,26H,(H,28,29) |
| InChIKey | AIULERYCWUVQDH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 133.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.25 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-[3-(1,2,2-tricyanoethenylamino)phenyl]quinoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-[3-(1,2,2-tricyanoethenylamino)phenyl]quinoline-4-carboxylic acid?
The IUPAC name of 6-bromo-2-[3-(1,2,2-tricyanoethenylamino)phenyl]quinoline-4-carboxylic acid (CID 168608649) is 6-bromo-2-[3-(1,2,2-tricyanoethenylamino)phenyl]quinoline-4-carboxylic acid.
What is the SMILES notation for 6-bromo-2-[3-(1,2,2-tricyanoethenylamino)phenyl]quinoline-4-carboxylic acid?
The canonical SMILES for 6-bromo-2-[3-(1,2,2-tricyanoethenylamino)phenyl]quinoline-4-carboxylic acid is N#CC(C#N)=C(C#N)Nc1cccc(-c2cc(C(=O)O)c3cc(Br)ccc3n2)c1.
What is the InChIKey of 6-bromo-2-[3-(1,2,2-tricyanoethenylamino)phenyl]quinoline-4-carboxylic acid?
The InChIKey is AIULERYCWUVQDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H10BrN5O2/c22-14-4-5-18-16(7-14)17(21(28)29)8-19(27-18)12-2-1-3-15(6-12)26-20(11-25)13(9-23)10-24/h1-8,26H,(H,28,29).
What are the key properties of 6-bromo-2-[3-(1,2,2-tricyanoethenylamino)phenyl]quinoline-4-carboxylic acid?
6-bromo-2-[3-(1,2,2-tricyanoethenylamino)phenyl]quinoline-4-carboxylic acid has a molecular weight of 444.25 g/mol, XLogP of 4.60, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-[3-(1,2,2-tricyanoethenylamino)phenyl]quinoline-4-carboxylic acid is sourced from PubChem (CID 168608649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).