C20H11BrN4O2 — CID 168543505
6-bromo-2-[3-(2,2-dicyanoethenylamino)phenyl]quinoline-4-carboxylic acid (PubChem CID 168543505) has the molecular formula C20H11BrN4O2 and a molecular weight of 419.24 g/mol. Its IUPAC name is 6-bromo-2-[3-(2,2-dicyanoethenylamino)phenyl]quinoline-4-carboxylic acid.
| Compound Name | 6-bromo-2-[3-(2,2-dicyanoethenylamino)phenyl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 168543505 |
| Molecular Formula | C20H11BrN4O2 |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 6-bromo-2-[3-(2,2-dicyanoethenylamino)phenyl]quinoline-4-carboxylic acid |
| SMILES | N#CC(C#N)=CNc1cccc(-c2cc(C(=O)O)c3cc(Br)ccc3n2)c1 |
| InChI | InChI=1S/C20H11BrN4O2/c21-14-4-5-18-16(7-14)17(20(26)27)8-19(25-18)13-2-1-3-15(6-13)24-11-12(9-22)10-23/h1-8,11,24H,(H,26,27) |
| InChIKey | BGIHNYJISCCDQY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|