C23H17ClN2O6 — CID 168539371
6-chloro-2-[3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]quinoline-4-carboxylic acid (PubChem CID 168539371) has the molecular formula C23H17ClN2O6 and a molecular weight of 452.85 g/mol. Its IUPAC name is 6-chloro-2-[3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]quinoline-4-carboxylic acid.
| Compound Name | 6-chloro-2-[3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 168539371 |
| Molecular Formula | C23H17ClN2O6 |
| Molecular Weight | 452.85 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 6-chloro-2-[3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]quinoline-4-carboxylic acid |
| SMILES | CC1(C)OC(=O)C(=CNc2cccc(-c3cc(C(=O)O)c4cc(Cl)ccc4n3)c2)C(=O)O1 |
| InChI | InChI=1S/C23H17ClN2O6/c1-23(2)31-21(29)17(22(30)32-23)11-25-14-5-3-4-12(8-14)19-10-16(20(27)28)15-9-13(24)6-7-18(15)26-19/h3-11,25H,1-2H3,(H,27,28) |
| InChIKey | RSJCRHUXOUFNMV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.85 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|