C19H12N4S — CID 168544214
2-[[3-(4-phenyl-1,3-thiazol-2-yl)anilino]methylidene]propanedinitrile (PubChem CID 168544214) has the molecular formula C19H12N4S and a molecular weight of 328.40 g/mol. Its IUPAC name is 2-[[3-(4-phenyl-1,3-thiazol-2-yl)anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[3-(4-phenyl-1,3-thiazol-2-yl)anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168544214 |
| Molecular Formula | C19H12N4S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-[[3-(4-phenyl-1,3-thiazol-2-yl)anilino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1cccc(-c2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C19H12N4S/c20-10-14(11-21)12-22-17-8-4-7-16(9-17)19-23-18(13-24-19)15-5-2-1-3-6-15/h1-9,12-13,22H |
| InChIKey | OGTOSIZYBBISAZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|