C20H12N6O — CID 168607088
2-[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168607088) has the molecular formula C20H12N6O and a molecular weight of 352.36 g/mol. Its IUPAC name is 2-[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168607088 |
| Molecular Formula | C20H12N6O |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | Cc1ccc(-c2noc(-c3ccc(NC(C#N)=C(C#N)C#N)cc3)n2)cc1 |
| InChI | InChI=1S/C20H12N6O/c1-13-2-4-14(5-3-13)19-25-20(27-26-19)15-6-8-17(9-7-15)24-18(12-23)16(10-21)11-22/h2-9,24H,1H3 |
| InChIKey | ZLLNWGAXYJABAZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|