C16H14N4OS — CID 169356713
[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl]thiourea (PubChem CID 169356713) has the molecular formula C16H14N4OS and a molecular weight of 310.38 g/mol. Its IUPAC name is [4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl]thiourea.
| Compound Name | [4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl]thiourea |
|---|---|
| PubChem CID | 169356713 |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | [4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl]thiourea |
| SMILES | Cc1ccc(-c2noc(-c3ccc(NC(N)=S)cc3)n2)cc1 |
| InChI | InChI=1S/C16H14N4OS/c1-10-2-4-11(5-3-10)14-19-15(21-20-14)12-6-8-13(9-7-12)18-16(17)22/h2-9H,1H3,(H3,17,18,22) |
| InChIKey | QTKLLLUUYWCPKS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|