[4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid

C14H10N4O3 — CID 21483705

IUPAC[4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid
SMILESO=C(O)Nc1ccc(-c2noc(-c3ccncc3)n2)cc1
InChIInChI=1S/C14H10N4O3/c19-14(20)16-11-3-1-9(2-4-11)12-17-13(21-18-12)10-5-7-15-8-6-10/h1-8,16H,(H,19,20)
InChIKeySFNCTEMOEYGWCW-UHFFFAOYSA-N
MW282.26 g/mol
LogP2.89
Rot. Bonds3

About [4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid

[4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid (PubChem CID 21483705) has the molecular formula C14H10N4O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is [4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid.

Molecular Properties

Compound Name[4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid
PubChem CID21483705
Molecular FormulaC14H10N4O3
Molecular Weight282.26 g/mol
Exact Mass282.08
IUPAC Name[4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid
SMILESO=C(O)Nc1ccc(-c2noc(-c3ccncc3)n2)cc1
InChIInChI=1S/C14H10N4O3/c19-14(20)16-11-3-1-9(2-4-11)12-17-13(21-18-12)10-5-7-15-8-6-10/h1-8,16H,(H,19,20)
InChIKeySFNCTEMOEYGWCW-UHFFFAOYSA-N
XLogP2.89
TPSA101.14 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.26
LogP ≤ 52.89
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze [4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid?
The IUPAC name of [4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid (CID 21483705) is [4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid.
What is the SMILES notation for [4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid?
The canonical SMILES for [4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid is O=C(O)Nc1ccc(-c2noc(-c3ccncc3)n2)cc1.
What is the InChIKey of [4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid?
The InChIKey is SFNCTEMOEYGWCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4O3/c19-14(20)16-11-3-1-9(2-4-11)12-17-13(21-18-12)10-5-7-15-8-6-10/h1-8,16H,(H,19,20).
What are the key properties of [4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid?
[4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid has a molecular weight of 282.26 g/mol, XLogP of 2.89, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid is sourced from PubChem (CID 21483705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).