C14H10N4O3 — CID 21483705
[4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid (PubChem CID 21483705) has the molecular formula C14H10N4O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is [4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid.
| Compound Name | [4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 21483705 |
| Molecular Formula | C14H10N4O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | [4-(5-pyridin-4-yl-1,2,4-oxadiazol-3-yl)phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(-c2noc(-c3ccncc3)n2)cc1 |
| InChI | InChI=1S/C14H10N4O3/c19-14(20)16-11-3-1-9(2-4-11)12-17-13(21-18-12)10-5-7-15-8-6-10/h1-8,16H,(H,19,20) |
| InChIKey | SFNCTEMOEYGWCW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |