C13H16ClN5O3 — CID 72936303
1-[3-chloro-4-(1,2,4-triazol-1-yl)phenyl]-3-[2-(2-hydroxyethoxy)ethyl]urea (PubChem CID 72936303) has the molecular formula C13H16ClN5O3 and a molecular weight of 325.76 g/mol. Its IUPAC name is 1-[3-chloro-4-(1,2,4-triazol-1-yl)phenyl]-3-[2-(2-hydroxyethoxy)ethyl]urea.
| Compound Name | 1-[3-chloro-4-(1,2,4-triazol-1-yl)phenyl]-3-[2-(2-hydroxyethoxy)ethyl]urea |
|---|---|
| PubChem CID | 72936303 |
| Molecular Formula | C13H16ClN5O3 |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 1-[3-chloro-4-(1,2,4-triazol-1-yl)phenyl]-3-[2-(2-hydroxyethoxy)ethyl]urea |
| SMILES | O=C(NCCOCCO)Nc1ccc(-n2cncn2)c(Cl)c1 |
| InChI | InChI=1S/C13H16ClN5O3/c14-11-7-10(1-2-12(11)19-9-15-8-17-19)18-13(21)16-3-5-22-6-4-20/h1-2,7-9,20H,3-6H2,(H2,16,18,21) |
| InChIKey | AJHFSLQCIFETRI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|