C27H31N7O3 — CID 130328513
1-[3-[4-(4-methyl-3-pyrrolidin-1-ylphenyl)piperazin-1-yl]propyl]-2-oxidotriazolo[4,5-g]quinolin-2-ium-4,9-dione (PubChem CID 130328513) has the molecular formula C27H31N7O3 and a molecular weight of 501.59 g/mol. Its IUPAC name is 1-[3-[4-(4-methyl-3-pyrrolidin-1-ylphenyl)piperazin-1-yl]propyl]-2-oxidotriazolo[4,5-g]quinolin-2-ium-4,9-dione.
| Compound Name | 1-[3-[4-(4-methyl-3-pyrrolidin-1-ylphenyl)piperazin-1-yl]propyl]-2-oxidotriazolo[4,5-g]quinolin-2-ium-4,9-dione |
|---|---|
| PubChem CID | 130328513 |
| Molecular Formula | C27H31N7O3 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 1-[3-[4-(4-methyl-3-pyrrolidin-1-ylphenyl)piperazin-1-yl]propyl]-2-oxidotriazolo[4,5-g]quinolin-2-ium-4,9-dione |
| SMILES | Cc1ccc(N2CCN(CCCn3c4c(n[n+]3[O-])C(=O)c3ncccc3C4=O)CC2)cc1N1CCCC1 |
| InChI | InChI=1S/C27H31N7O3/c1-19-7-8-20(18-22(19)32-11-2-3-12-32)31-16-14-30(15-17-31)10-5-13-33-25-24(29-34(33)37)27(36)23-21(26(25)35)6-4-9-28-23/h4,6-9,18H,2-3,5,10-17H2,1H3 |
| InChIKey | AZKVRFDVJLEXMP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 101.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|