C28H33N7O5 — CID 25196297
3-[3-[4-[3-(2,2-dimethylpropylamino)-4-nitrophenyl]piperazin-1-yl]propyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione (PubChem CID 25196297) has the molecular formula C28H33N7O5 and a molecular weight of 547.62 g/mol. Its IUPAC name is 3-[3-[4-[3-(2,2-dimethylpropylamino)-4-nitrophenyl]piperazin-1-yl]propyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione.
| Compound Name | 3-[3-[4-[3-(2,2-dimethylpropylamino)-4-nitrophenyl]piperazin-1-yl]propyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione |
|---|---|
| PubChem CID | 25196297 |
| Molecular Formula | C28H33N7O5 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | 3-[3-[4-[3-(2,2-dimethylpropylamino)-4-nitrophenyl]piperazin-1-yl]propyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione |
| SMILES | CC(C)(C)CNc1cc(N2CCN(CCCn3c4c(n[n+]3[O-])C(=O)c3ccccc3C4=O)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H33N7O5/c1-28(2,3)18-29-22-17-19(9-10-23(22)34(38)39)32-15-13-31(14-16-32)11-6-12-33-25-24(30-35(33)40)26(36)20-7-4-5-8-21(20)27(25)37/h4-5,7-10,17,29H,6,11-16,18H2,1-3H3 |
| InChIKey | XCEQLORGBMADCU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|