C26H29N5O3 — CID 130182523
2-oxido-3-[3-[4-(1-tetracyclo[3.3.1.03,9.07,9]nonanyl)piperazin-1-yl]propyl]benzo[f]benzotriazol-2-ium-4,9-dione (PubChem CID 130182523) has the molecular formula C26H29N5O3 and a molecular weight of 459.55 g/mol. Its IUPAC name is 2-oxido-3-[3-[4-(1-tetracyclo[3.3.1.03,9.07,9]nonanyl)piperazin-1-yl]propyl]benzo[f]benzotriazol-2-ium-4,9-dione.
| Compound Name | 2-oxido-3-[3-[4-(1-tetracyclo[3.3.1.03,9.07,9]nonanyl)piperazin-1-yl]propyl]benzo[f]benzotriazol-2-ium-4,9-dione |
|---|---|
| PubChem CID | 130182523 |
| Molecular Formula | C26H29N5O3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 2-oxido-3-[3-[4-(1-tetracyclo[3.3.1.03,9.07,9]nonanyl)piperazin-1-yl]propyl]benzo[f]benzotriazol-2-ium-4,9-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1n[n+]([O-])n2CCCN1CCN(C23CC4CC5CC(C2)C543)CC1 |
| InChI | InChI=1S/C26H29N5O3/c32-23-19-4-1-2-5-20(19)24(33)22-21(23)27-31(34)30(22)7-3-6-28-8-10-29(11-9-28)25-14-17-12-16-13-18(15-25)26(16,17)25/h1-2,4-5,16-18H,3,6-15H2 |
| InChIKey | JYYOBCAZCOXUDL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|