C28H29N7O3 — CID 70837365
3-[3-[4-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]phenyl]propyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione (PubChem CID 70837365) has the molecular formula C28H29N7O3 and a molecular weight of 511.59 g/mol. Its IUPAC name is 3-[3-[4-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]phenyl]propyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione.
| Compound Name | 3-[3-[4-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]phenyl]propyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione |
|---|---|
| PubChem CID | 70837365 |
| Molecular Formula | C28H29N7O3 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 3-[3-[4-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]phenyl]propyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione |
| SMILES | Cn1cc(CN2CCN(c3ccc(CCCn4c5c(n[n+]4[O-])C(=O)c4ccccc4C5=O)cc3)CC2)cn1 |
| InChI | InChI=1S/C28H29N7O3/c1-31-18-21(17-29-31)19-32-13-15-33(16-14-32)22-10-8-20(9-11-22)5-4-12-34-26-25(30-35(34)38)27(36)23-6-2-3-7-24(23)28(26)37/h2-3,6-11,17-18H,4-5,12-16,19H2,1H3 |
| InChIKey | PDYWGKQGKFEJQD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 103.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|