C14H20N6 — CID 62127280
5-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]pyridin-2-amine (PubChem CID 62127280) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is 5-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]pyridin-2-amine.
| Compound Name | 5-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 62127280 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 5-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]pyridin-2-amine |
| SMILES | Cn1cc(CN2CCN(c3ccc(N)nc3)CC2)cn1 |
| InChI | InChI=1S/C14H20N6/c1-18-10-12(8-17-18)11-19-4-6-20(7-5-19)13-2-3-14(15)16-9-13/h2-3,8-10H,4-7,11H2,1H3,(H2,15,16) |
| InChIKey | ZPEFGTXYUMOYTL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |