C16H19BrN4 — CID 43461948
5-[4-[(4-bromophenyl)methyl]piperazin-1-yl]pyridin-2-amine (PubChem CID 43461948) has the molecular formula C16H19BrN4 and a molecular weight of 347.26 g/mol. Its IUPAC name is 5-[4-[(4-bromophenyl)methyl]piperazin-1-yl]pyridin-2-amine.
| Compound Name | 5-[4-[(4-bromophenyl)methyl]piperazin-1-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 43461948 |
| Molecular Formula | C16H19BrN4 |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 5-[4-[(4-bromophenyl)methyl]piperazin-1-yl]pyridin-2-amine |
| SMILES | Nc1ccc(N2CCN(Cc3ccc(Br)cc3)CC2)cn1 |
| InChI | InChI=1S/C16H19BrN4/c17-14-3-1-13(2-4-14)12-20-7-9-21(10-8-20)15-5-6-16(18)19-11-15/h1-6,11H,7-10,12H2,(H2,18,19) |
| InChIKey | HWAHULFSEBHZBG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |