C15H22N6 — CID 103003357
5-[4-[2-(1-methylpyrazol-4-yl)ethyl]piperazin-1-yl]pyridin-2-amine (PubChem CID 103003357) has the molecular formula C15H22N6 and a molecular weight of 286.38 g/mol. Its IUPAC name is 5-[4-[2-(1-methylpyrazol-4-yl)ethyl]piperazin-1-yl]pyridin-2-amine.
| Compound Name | 5-[4-[2-(1-methylpyrazol-4-yl)ethyl]piperazin-1-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 103003357 |
| Molecular Formula | C15H22N6 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 5-[4-[2-(1-methylpyrazol-4-yl)ethyl]piperazin-1-yl]pyridin-2-amine |
| SMILES | Cn1cc(CCN2CCN(c3ccc(N)nc3)CC2)cn1 |
| InChI | InChI=1S/C15H22N6/c1-19-12-13(10-18-19)4-5-20-6-8-21(9-7-20)14-2-3-15(16)17-11-14/h2-3,10-12H,4-9H2,1H3,(H2,16,17) |
| InChIKey | RYUBMZMNDQYFJA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |