C13H17ClN6 — CID 86641657
2-chloro-3-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine (PubChem CID 86641657) has the molecular formula C13H17ClN6 and a molecular weight of 292.77 g/mol. Its IUPAC name is 2-chloro-3-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine.
| Compound Name | 2-chloro-3-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine |
|---|---|
| PubChem CID | 86641657 |
| Molecular Formula | C13H17ClN6 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-chloro-3-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]pyrazine |
| SMILES | Cn1cc(CN2CCN(c3nccnc3Cl)CC2)cn1 |
| InChI | InChI=1S/C13H17ClN6/c1-18-9-11(8-17-18)10-19-4-6-20(7-5-19)13-12(14)15-2-3-16-13/h2-3,8-9H,4-7,10H2,1H3 |
| InChIKey | BWIMWLVGQUJNLK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |