C20H22FN5 — CID 59321981
1-[2-(4-fluorophenyl)-3-pyridinyl]-4-[(1-methylpyrazol-4-yl)methyl]piperazine (PubChem CID 59321981) has the molecular formula C20H22FN5 and a molecular weight of 351.43 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-3-pyridinyl]-4-[(1-methylpyrazol-4-yl)methyl]piperazine.
| Compound Name | 1-[2-(4-fluorophenyl)-3-pyridinyl]-4-[(1-methylpyrazol-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 59321981 |
| Molecular Formula | C20H22FN5 |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-3-pyridinyl]-4-[(1-methylpyrazol-4-yl)methyl]piperazine |
| SMILES | Cn1cc(CN2CCN(c3cccnc3-c3ccc(F)cc3)CC2)cn1 |
| InChI | InChI=1S/C20H22FN5/c1-24-14-16(13-23-24)15-25-9-11-26(12-10-25)19-3-2-8-22-20(19)17-4-6-18(21)7-5-17/h2-8,13-14H,9-12,15H2,1H3 |
| InChIKey | CJSLVRINLBUOPR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |