C23H22N6O5 — CID 71030269
3-[3-[4-(3-nitrophenyl)piperazin-1-yl]propyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione (PubChem CID 71030269) has the molecular formula C23H22N6O5 and a molecular weight of 462.47 g/mol. Its IUPAC name is 3-[3-[4-(3-nitrophenyl)piperazin-1-yl]propyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione.
| Compound Name | 3-[3-[4-(3-nitrophenyl)piperazin-1-yl]propyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione |
|---|---|
| PubChem CID | 71030269 |
| Molecular Formula | C23H22N6O5 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 3-[3-[4-(3-nitrophenyl)piperazin-1-yl]propyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1n[n+]([O-])n2CCCN1CCN(c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C23H22N6O5/c30-22-18-7-1-2-8-19(18)23(31)21-20(22)24-29(34)27(21)10-4-9-25-11-13-26(14-12-25)16-5-3-6-17(15-16)28(32)33/h1-3,5-8,15H,4,9-14H2 |
| InChIKey | GWAIEOJUHGYHSO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 128.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|