C36H33N5O3 — CID 130328503
3-[2-[4-[4-[[2-(4-methylphenyl)phenyl]methyl]piperazin-1-yl]phenyl]ethyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione (PubChem CID 130328503) has the molecular formula C36H33N5O3 and a molecular weight of 583.69 g/mol. Its IUPAC name is 3-[2-[4-[4-[[2-(4-methylphenyl)phenyl]methyl]piperazin-1-yl]phenyl]ethyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione.
| Compound Name | 3-[2-[4-[4-[[2-(4-methylphenyl)phenyl]methyl]piperazin-1-yl]phenyl]ethyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione |
|---|---|
| PubChem CID | 130328503 |
| Molecular Formula | C36H33N5O3 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | 3-[2-[4-[4-[[2-(4-methylphenyl)phenyl]methyl]piperazin-1-yl]phenyl]ethyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione |
| SMILES | Cc1ccc(-c2ccccc2CN2CCN(c3ccc(CCn4c5c(n[n+]4[O-])C(=O)c4ccccc4C5=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C36H33N5O3/c1-25-10-14-27(15-11-25)30-7-3-2-6-28(30)24-38-20-22-39(23-21-38)29-16-12-26(13-17-29)18-19-40-34-33(37-41(40)44)35(42)31-8-4-5-9-32(31)36(34)43/h2-17H,18-24H2,1H3 |
| InChIKey | KLJBDDKVOQMNCA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|