C26H27N5O4 — CID 130328525
3-[3-[4-(4-ethylbenzoyl)piperazin-1-yl]propyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione (PubChem CID 130328525) has the molecular formula C26H27N5O4 and a molecular weight of 473.53 g/mol. Its IUPAC name is 3-[3-[4-(4-ethylbenzoyl)piperazin-1-yl]propyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione.
| Compound Name | 3-[3-[4-(4-ethylbenzoyl)piperazin-1-yl]propyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione |
|---|---|
| PubChem CID | 130328525 |
| Molecular Formula | C26H27N5O4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 3-[3-[4-(4-ethylbenzoyl)piperazin-1-yl]propyl]-2-oxidobenzo[f]benzotriazol-2-ium-4,9-dione |
| SMILES | CCc1ccc(C(=O)N2CCN(CCCn3c4c(n[n+]3[O-])C(=O)c3ccccc3C4=O)CC2)cc1 |
| InChI | InChI=1S/C26H27N5O4/c1-2-18-8-10-19(11-9-18)26(34)29-16-14-28(15-17-29)12-5-13-30-23-22(27-31(30)35)24(32)20-6-3-4-7-21(20)25(23)33/h3-4,6-11H,2,5,12-17H2,1H3 |
| InChIKey | QFIQNWQMVYREDH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|