C21H19N7O4 — CID 25195637
2-oxido-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzo[f]benzotriazol-2-ium-4,9-dione (PubChem CID 25195637) has the molecular formula C21H19N7O4 and a molecular weight of 433.43 g/mol. Its IUPAC name is 2-oxido-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzo[f]benzotriazol-2-ium-4,9-dione.
| Compound Name | 2-oxido-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzo[f]benzotriazol-2-ium-4,9-dione |
|---|---|
| PubChem CID | 25195637 |
| Molecular Formula | C21H19N7O4 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-oxido-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]benzo[f]benzotriazol-2-ium-4,9-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1n[n+]([O-])n2CCC(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H19N7O4/c29-16(25-10-12-26(13-11-25)21-22-7-3-8-23-21)6-9-27-18-17(24-28(27)32)19(30)14-4-1-2-5-15(14)20(18)31/h1-5,7-8H,6,9-13H2 |
| InChIKey | JFYLSPBXYBNSHY-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 128.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|