C21H21N3O3S2 — CID 3312116
ethyl 4-[4-amino-5-(2-phenylethylcarbamoyl)-2-sulfanylidene-1,3-thiazol-3-yl]benzoate (PubChem CID 3312116) has the molecular formula C21H21N3O3S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is ethyl 4-[4-amino-5-(2-phenylethylcarbamoyl)-2-sulfanylidene-1,3-thiazol-3-yl]benzoate.
| Compound Name | ethyl 4-[4-amino-5-(2-phenylethylcarbamoyl)-2-sulfanylidene-1,3-thiazol-3-yl]benzoate |
|---|---|
| PubChem CID | 3312116 |
| Molecular Formula | C21H21N3O3S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | ethyl 4-[4-amino-5-(2-phenylethylcarbamoyl)-2-sulfanylidene-1,3-thiazol-3-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(N)c(C(=O)NCCc3ccccc3)sc2=S)cc1 |
| InChI | InChI=1S/C21H21N3O3S2/c1-2-27-20(26)15-8-10-16(11-9-15)24-18(22)17(29-21(24)28)19(25)23-13-12-14-6-4-3-5-7-14/h3-11H,2,12-13,22H2,1H3,(H,23,25) |
| InChIKey | WANJVQSAKXQVQT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_B(17)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|