C24H26BrN3O3 — CID 46082381
ethyl 4-bromo-5-methyl-1-[4-(4-phenylbutylcarbamoyl)phenyl]pyrazole-3-carboxylate (PubChem CID 46082381) has the molecular formula C24H26BrN3O3 and a molecular weight of 484.39 g/mol. Its IUPAC name is ethyl 4-bromo-5-methyl-1-[4-(4-phenylbutylcarbamoyl)phenyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 4-bromo-5-methyl-1-[4-(4-phenylbutylcarbamoyl)phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46082381 |
| Molecular Formula | C24H26BrN3O3 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | ethyl 4-bromo-5-methyl-1-[4-(4-phenylbutylcarbamoyl)phenyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(C(=O)NCCCCc3ccccc3)cc2)c(C)c1Br |
| InChI | InChI=1S/C24H26BrN3O3/c1-3-31-24(30)22-21(25)17(2)28(27-22)20-14-12-19(13-15-20)23(29)26-16-8-7-11-18-9-5-4-6-10-18/h4-6,9-10,12-15H,3,7-8,11,16H2,1-2H3,(H,26,29) |
| InChIKey | LGXPRICOCWZHNA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|