C25H29N5O2 — CID 68519299
N-cyclopropyl-1-[4-(3-phenylpropylcarbamoyl)phenyl]-5-propyltriazole-4-carboxamide (PubChem CID 68519299) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-cyclopropyl-1-[4-(3-phenylpropylcarbamoyl)phenyl]-5-propyltriazole-4-carboxamide.
| Compound Name | N-cyclopropyl-1-[4-(3-phenylpropylcarbamoyl)phenyl]-5-propyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 68519299 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | N-cyclopropyl-1-[4-(3-phenylpropylcarbamoyl)phenyl]-5-propyltriazole-4-carboxamide |
| SMILES | CCCc1c(C(=O)NC2CC2)nnn1-c1ccc(C(=O)NCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H29N5O2/c1-2-7-22-23(25(32)27-20-13-14-20)28-29-30(22)21-15-11-19(12-16-21)24(31)26-17-6-10-18-8-4-3-5-9-18/h3-5,8-9,11-12,15-16,20H,2,6-7,10,13-14,17H2,1H3,(H,26,31)(H,27,32) |
| InChIKey | MEZIAWWIKHEHKB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|