C20H28N4O3 — CID 119352643
4-[[1-(4-tert-butylphenyl)-5-propyltriazole-4-carbonyl]amino]butanoic acid (PubChem CID 119352643) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-[[1-(4-tert-butylphenyl)-5-propyltriazole-4-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[1-(4-tert-butylphenyl)-5-propyltriazole-4-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119352643 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 4-[[1-(4-tert-butylphenyl)-5-propyltriazole-4-carbonyl]amino]butanoic acid |
| SMILES | CCCc1c(C(=O)NCCCC(=O)O)nnn1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H28N4O3/c1-5-7-16-18(19(27)21-13-6-8-17(25)26)22-23-24(16)15-11-9-14(10-12-15)20(2,3)4/h9-12H,5-8,13H2,1-4H3,(H,21,27)(H,25,26) |
| InChIKey | RQSJBDQUQKBLGI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|