C24H23F3IN5O3 — CID 89311644
N-cyclopropyl-1-[4-(ethylcarbamoyl)phenyl]-5-[[2-(iodomethyl)-3-(trifluoromethyl)phenoxy]methyl]triazole-4-carboxamide (PubChem CID 89311644) has the molecular formula C24H23F3IN5O3 and a molecular weight of 613.38 g/mol. Its IUPAC name is N-cyclopropyl-1-[4-(ethylcarbamoyl)phenyl]-5-[[2-(iodomethyl)-3-(trifluoromethyl)phenoxy]methyl]triazole-4-carboxamide.
| Compound Name | N-cyclopropyl-1-[4-(ethylcarbamoyl)phenyl]-5-[[2-(iodomethyl)-3-(trifluoromethyl)phenoxy]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 89311644 |
| Molecular Formula | C24H23F3IN5O3 |
| Molecular Weight | 613.38 g/mol |
| Exact Mass | 613.08 |
| IUPAC Name | N-cyclopropyl-1-[4-(ethylcarbamoyl)phenyl]-5-[[2-(iodomethyl)-3-(trifluoromethyl)phenoxy]methyl]triazole-4-carboxamide |
| SMILES | CCNC(=O)c1ccc(-n2nnc(C(=O)NC3CC3)c2COc2cccc(C(F)(F)F)c2CI)cc1 |
| InChI | InChI=1S/C24H23F3IN5O3/c1-2-29-22(34)14-6-10-16(11-7-14)33-19(21(31-32-33)23(35)30-15-8-9-15)13-36-20-5-3-4-18(17(20)12-28)24(25,26)27/h3-7,10-11,15H,2,8-9,12-13H2,1H3,(H,29,34)(H,30,35) |
| InChIKey | HXVFXASHWQFART-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|