C26H30N2O3 — CID 43954514
ethyl 1-benzyl-3,5-dimethyl-4-(3-phenylpropylcarbamoyl)pyrrole-2-carboxylate (PubChem CID 43954514) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is ethyl 1-benzyl-3,5-dimethyl-4-(3-phenylpropylcarbamoyl)pyrrole-2-carboxylate.
| Compound Name | ethyl 1-benzyl-3,5-dimethyl-4-(3-phenylpropylcarbamoyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 43954514 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | ethyl 1-benzyl-3,5-dimethyl-4-(3-phenylpropylcarbamoyl)pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(C)c(C(=O)NCCCc2ccccc2)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C26H30N2O3/c1-4-31-26(30)24-19(2)23(20(3)28(24)18-22-14-9-6-10-15-22)25(29)27-17-11-16-21-12-7-5-8-13-21/h5-10,12-15H,4,11,16-18H2,1-3H3,(H,27,29) |
| InChIKey | YWEYUQBMPUOFFI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|